| Identification | |
| Name: | Thiazolo[5,4-d]pyrimidine,5,7-dichloro- |
| Synonyms: | 5,7-Dichloro[1,3]thiazolo[5,4-d]pyrimidine;Thiazolo[5,4-d]pyrimidine, 5,7-dichloro-;5,7-dichloro[1,3]thiazolo[5,4-d]pyrimidine; |
| CAS: | 13479-88-4 |
| Molecular Formula: | C5HCl2N3S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5HCl2N3S/c6-3-2-4(11-1-8-2)10-5(7)9-3/h1H |
| Molecular Structure: | ![(C5HCl2N3S) 5,7-Dichloro[1,3]thiazolo[5,4-d]pyrimidine;Thiazolo[5,4-d]pyrimidine, 5,7-dichloro-;5,7-dichloro[1,3...](https://img1.guidechem.com/chem/e/dict/220/13479-88-4.jpg) |
| Properties | |
| Density: | 1.767g/cm3 |
| Refractive index: | 1.73 |
| Specification: |
The 5,7-Dichlorothiazolo[5,4-d]pyrimidine, with the cas registry number 13479-88-4, is also called 5,7-dichloro[1,3]thiazolo[5,4-d]pyrimidine. And the molecular formula of the chemical is C5HCl2N3S. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.31; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.31; (4)ACD/LogD (pH 7.4): 1.31; (5)ACD/BCF (pH 5.5): 5.79; (6)ACD/BCF (pH 7.4): 5.79; (7)ACD/KOC (pH 5.5): 122.3; (8)ACD/KOC (pH 7.4): 122.3; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 66.91 Å2; (13)Index of Refraction: 1.73; (14)Molar Refractivity: 46.54 cm3; (15)Molar Volume: 116.6 cm3; (16)Polarizability: 18.45×10-24cm3; (17)Surface Tension: 79.7 dyne/cm; (18)Density: 1.767 g/cm3; (19)Flash Point: 123.9 °C; (20)Enthalpy of Vaporization: 49.91 kJ/mol; (21)Boiling Point: 281.2 °C at 760 mmHg; (22)Vapour Pressure: 0.00615 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
