| Identification | |
| Name: | Cyclohexanone,4-hydroxy- |
| Synonyms: | p-Hydroxycyclohexanone;Cyclohexanone, 4-hydroxy-;4-Hydroxycyclohexan-1-one;4-Oxocyclohexan-1-ol;AC1LBWOD;Jsp002121;CID543706; |
| CAS: | 13482-22-9 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c7-5-1-2-6(8)4-3-5/h5,7H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -1 ºC |
| Flash Point: | 124 ºC |
| Boiling Point: | 256 ºC |
| Density: | 1,1 g/cm3 |
| Refractive index: | 1.5 |
| Specification: |
4-Hydroxycyclohexanone , its cas register number is 13482-22-9. It also can be called Cyclohexanone, 4-hydroxy- ; p-Hydroxycyclohexanone . 4-Hydroxycyclohexanone (CAS NO.13482-22-9) is irritating to eyes, respiratory system and skin. |
| Flash Point: | 124 ºC |
| Safety Data | |
 |
|
