Identification |
Name: | Pentacene |
Synonyms: | 2,3:6,7-Dibenzanthracene;Benzo[b]naphthacene;Dibenz[b,i]anthracene;NSC 90784;lin-Dibenzanthracene;lin-Naphthoanthracene; |
CAS: | 135-48-8 |
EINECS: | 205-193-7 |
Molecular Formula: | C22H14 |
Molecular Weight: | 278.35 |
InChI: | InChI=1/C22H14/c1-2-6-16-10-20-14-22-12-18-8-4-3-7-17(18)11-21(22)13-19(20)9-15(16)5-1/h1-14H |
Molecular Structure: |
|
Properties |
Density: | 1.232 g/cm3 |
Stability: | Stable, but air and light sensitive. Incompatible with strong oxidizing agents. |
Refractive index: | 1.811 |
Water Solubility: | insoluble |
Solubility: | Insoluble in water |
Appearance: | solid |
Report: |
Reported in EPA TSCA Inventory.
|
Storage Temperature: | 0-6°C |
Usage: | Potential use in organic thin film transistors. |
Safety Data |
|
|