| Identification |
| Name: | Pindolol |
| Synonyms: | - |
| CAS: | 13523-86-9 |
| EINECS: | 236-867-9 |
| Molecular Formula: | C14H20N2O2 |
| Molecular Weight: | 248.32 |
| InChI: | InChI=1/C14H20N2O2/c1-10(2)16-8-11(17)9-18-14-5-3-4-13-12(14)6-7-15-13/h3-7,10-11,15-17H,8-9H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3249 |
| Flash Point: | 230.3°C |
| Boiling Point: | 457.1°Cat760mmHg |
| Density: | 1.152g/cm3 |
| Stability: | Pindolol tablets should be protected from light and stored in well-closed containers. |
| Solubility: | practically insoluble |
| Appearance: | Crystals from ethanol. Faint odor. |
| Packinggroup: | III |
| Biological Activity: | 5-HT 1A/1B ? receptor antagonist, with roughly equal affinity for each subtype. A partial agonist at mouse and human β 3 -adrenoceptors. |
| Flash Point: | 230.3°C |
| Storage Temperature: | 2-8°C |
| Color: | white to off-white |
| Usage: | Medication. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
