| Identification | |
| Name: | Ethanol,2,2'-hydrazinylidenebis- |
| Synonyms: | Ethanol,2,2'-hydrazonobis- (9CI); Ethanol, 2,2'-hydrazonodi- (7CI,8CI);1,1-Bis(2-hydroxyethyl)hydrazine; 1,1-Diethanolhydrazine;N,N-Bis(2-hydroxyethyl)hydrazine; N,N-Bis(b-hydroxyethyl)hydrazine |
| CAS: | 13529-51-6 |
| EINECS: | 236-873-1 |
| Molecular Formula: | C4H12 N2 O2 |
| Molecular Weight: | 120.18 |
| InChI: | InChI=1/C4H12N2O2/c5-6(1-3-7)2-4-8/h7-8H,1-5H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.2°C |
| Boiling Point: | 318.1°Cat760mmHg |
| Density: | 1.195g/cm3 |
| Refractive index: | 1.527 |
| Specification: |
This calculation was derived from laboratory measurements of an XC9500XV part filled with 16-bit counters and allowing a single output (the LSB) to be enabled.Fairchilds high voltage process and common-mode noise canceling technique give stable operation of high-side driver under high dv/dt noise circumstances.3V outputs.6V for read and program/erase operations.An ALE control line simplifies address demultiplexing.Increasing the decay time constant of the AGC circuit will impair the time to good data of the receiver from power up PD0 to PD2.indicates how the value of the pull-up resistor can be calculated). |
| Flash Point: | 146.2°C |
| Safety Data | |
 |
|
