| Identification | |
| Name: | Acetamiprid |
| Synonyms: | Ethanimidamide,N-[(6-chloro-3-pyridinyl)- methyl]-N'-cyano-N-methyl-,(1E)-;(E)-N-(6-Chloro-3-pyridyl)methyl-N-cyano-N-methylacetamidine;(1E)-N-[(6-Chloro-3-pyridinyl) methyl]-N'-cyano-N-methylethanimidamide;Acetamiprid,Burofezin,Bifenthrin,Cyfluthrin,carbofuran,Chlorpyrifos;Acetamiprid 20%SL; |
| CAS: | 135410-20-7 |
| Molecular Formula: | C10H11ClN4 |
| Molecular Weight: | 222.68 |
| InChI: | InChI=1S/C10H11ClN4/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9/h3-5H,6H2,1-2H3 |
| Molecular Structure: | ![(C10H11ClN4) Ethanimidamide,N-[(6-chloro-3-pyridinyl)- methyl]-N'-cyano-N-methyl-,(1E)-;(E)-N-(6-Chloro-3-pyridyl...](https://img1.guidechem.com/structure/image/135410-20-7.jpg) |
| Properties | |
| Transport: | UN 2811 |
| Melting Point: | 101-103 oC |
| Flash Point: | 166.9 oC |
| Boiling Point: | 352.4 oC at 760 mmHg |
| Density: | 1.17 g/cm3 |
| Water Solubility: | In water 4250 mg/l (25ºC). Soluble in acetone, methanol, ethanol, dichloromethane, chloroform, acetonitrile and tetrahydrofuran. |
| Solubility: | In water 4250 mg/l (25oC). Soluble in acetone, methanol, ethanol, dichloromethane, chloroform, acetonitrile and tetrahydrofuran. |
| Appearance: | white powder |
| Specification: |
?Acetamiprid [ISO] (CAS NO.135410-20-7), its Synonyms are Acetamiprid; (E)-N-(6-Chloro-3-pyridyl)methyl-N'-cyano-N-methylacetamidine ; Ethanimidamide, N-((6-chloro-3-pyridinyl)methyl)-N'-cyano-N-methyl-, (1E)- . It is white powder. |
| Packinggroup: | III |
| Flash Point: | 166.9 oC |
| Color: | White crystals White fine powder |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
