| Identification | |
| Name: | 2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride |
| Synonyms: | Methanone,(2,4-difluorophenyl)-4-piperidinyl-, oxime, monohydrochloride (9CI);1-(2,4-Difluorophenyl)-N-hydroxy-1-(piperidin-4-yl)methanimine hydrochloride (1:1);methanone, (2,4-difluorophenyl)-4-piperidinyl-, oxime, hydrochloride (1:1); |
| CAS: | 135634-18-3 |
| EINECS: | 424-740-2 |
| Molecular Formula: | C12H14F2N2O.HCl |
| Molecular Weight: | 276.71 |
| InChI: | InChI=1/C12H14F2N2O.ClH/c13-9-1-2-10(11(14)7-9)12(16-17)8-3-5-15-6-4-8;/h1-2,7-8,15,17H,3-6H2;1H/b16-12+; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185.6°C |
| Boiling Point: | 383.2°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
The 2,4-Difluorophenyl-(4-piperidinyl)methanone oxime hydrochloride with the cas number 135634-18-3, is also called methanone, (2,4-difluorophenyl)-4-piperidinyl-, oxime, hydrochloride (1:1).The product can be supplied by the following suppliers: (1)TIPR Pharmaceutical Responsible Co., Ltd.; (2)Hangzhou Sunny Chemical Co., Ltd.; (3)Link Chemicals Co.,Ltd.; (4)Beijing Gaobo Pharm-Chemicals Tech. Co., Ltd.; (5)Nanjing Chemlin Chemical Co., Ltd.. You can still convert the following datas into molecular structure: |
| Flash Point: | 185.6°C |
| Safety Data | |
 |
|
