| Identification | |
| Name: | Phosphorous acid |
| Synonyms: | Orthophosphorous acid; Phosphorousacidcrystalline; Phosphonic acid |
| CAS: | 13598-36-2 |
| EINECS: | 237-066-7 |
| Molecular Formula: | H3PO3 |
| Molecular Weight: | 82 |
| InChI: | InChI=1/H3O3P/c1-4(2)3/h4H,(H2,1,2,3) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2834 |
| Density: | 1.651 |
| Stability: | Stable. Incompatible with strong bases. Hygroscopic. |
| Water Solubility: | SOLUBLE |
| Solubility: | 310 g/100 mL in water; soluble in alcohol |
| Appearance: | white crystalline solid |
| Specification: |
?Phosphorous acid?(CAS NO.13598-36-2) can be formulated as HP(O)(OH)2 and therefore contains phosphorus in oxidation state +3. HP(O)2(OH)- is a moderately strong acid.The HP(O)2(OH)- species is called the hydrogenphosphite ion, and the HPO32- the phosphite ion. Both it and its deprotonated forms are good reducing agents, although not necessarily quick to react. They are oxidized to?it or its salts. It reduces solutions of noble metal cations to the metals. |
| Packinggroup: | III |
| Sensitive: | Air Sensitive & Hygroscopic |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
