| Identification | |
| Name: | Resorcinol monobenzoate |
| Synonyms: | - |
| CAS: | 136-36-7 |
| EINECS: | 205-241-7 |
| Molecular Formula: | C13H10O3 |
| Molecular Weight: | 214.2167 |
| InChI: | InChI=1S/C13H10O3/c14-11-7-4-8-12(9-11)16-13(15)10-5-2-1-3-6-10/h1-9,14H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 133-135 °C(lit.) |
| Flash Point: | 166.2°C |
| Boiling Point: | 379.5°Cat760mmHg |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.615 |
| Specification: |
3-Hydroxyphenyl benzoate (136-36-7) is white crystalline powder, known as Resorcinol monobenzoate ; 4-09-00-00372 (Beilstein Handbook Reference) ; Benzoic acid, m-hydroxyphenyl ester ; Eastman Inhibitor RMB ; NSC 4807 ; Resorcinol monobenzoate ; 1,3-Benzenediol, 1-benzoate ; 1,3-Benzenediol, monobenzoate ; Resorcinol, monobenzoate . It is incompatible with strong oxidizing agents. When heated to decomposition, it yields Carbon monoxide, Carbon dioxide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 166.2°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
