| Identification | |
| Name: | Hexylresorcinol |
| Synonyms: | Resorcinol,4-hexyl- (8CI);1,3-Dihydroxy-4-hexylbenzene;4-(1-Hexyl)resorcinol;4-Hexyl-1,3-dihydroxybenzene;4-Hexylresorcine;4-Hexylresorcinol;4-n-Hexylresorcinol;Adrover;Antascarin;Ascaricid;Ascarinol;Ascaryl; |
| CAS: | 136-77-6 |
| EINECS: | 205-257-4 |
| Molecular Formula: | C12H18O2 |
| Molecular Weight: | 194.27 |
| InChI: | InChI=1/C12H18O2/c1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h7-9,13-14H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.2 ºC |
| Density: | 1.049 g/cm3 |
| Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, oxidizing agents. |
| Refractive index: | 1.5101 (77 C) |
| Solubility: | 0.05 g/100 mL (18 oC) in water |
| Appearance: | slightly red powder |
| Specification: |
?Hexylresorcinol (CAS NO.136-77-6), its Synonyms are 1,3-Dihydroxy-4-hexylbenzene ; 1,3-Dihydroxy-4-n-hexylbenzene ; 4-(1-Hexyl)resorcinol ; 4-Hexyl-1,3-benzenediol ; 4-Hexyl-1,3-dihydroxybenzene ; 4-Hexylresorcine ; 4-Hexylresorcinol ; 4-n-Hexylresorcinol ; Crystoids ; Cystoids anthelmintic ; Worm-agen ; p-Hexylresorcinol . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29072900 |
| Flash Point: | 155.2 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Pale yellow, heavy liq becoming solid on standing at room temp; needles from benzene or petroleum ether WHITE, OR YELLOWISH WHITE, NEEDLE-SHAPED CRYSTALS; ACQUIRES BROWNISH PINK TINT ON EXPOSURE TO LIGHT & AIR |
| Usage: | Medication. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
