| Identification | |
| Name: | Ethanol,2-[(2-methylphenyl)amino]- |
| Synonyms: | Ethanol,2-o-toluidino- (7CI,8CI); 2-(o-Toluidino)ethanol; 2-o-Tolylaminoethanol;N-(2-Hydroxyethyl)-2-methylaniline; N-(2-Hydroxyethyl)-o-toluidine; N-b-Hydroxyethyl-o-toluidine; NSC2152; o-Toluidino ethanol; o-Tolyl ethanolamine |
| CAS: | 136-80-1 |
| EINECS: | 205-260-0 |
| Molecular Formula: | C9H13 N O |
| Molecular Weight: | 151.23 |
| InChI: | InChI=1/C9H13NO/c1-8-4-2-3-5-9(8)10-6-7-11/h2-5,10-11H,6-7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 145.6°C |
| Boiling Point: | 285.5°C at 760 mmHg |
| Density: | 1.086g/cm3 |
| Refractive index: | 1.588 |
| Specification: |
2-o-Toluidinoethanol ,its cas register number is 136-80-1. It also can be called 2-[(2-Methylphenyl)amino]ethanol ; ethanol, 2-[(2-methylphenyl)amino]- ; and 2-(o-Toluidino)ethanol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 145.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
