| Identification | |
| Name: | 2,4-Dithia-3-selena-6-azaoctanethioamide,N,N,6-triethyl-5-thioxo- |
| Synonyms: | Selenium,bis(diethyldithiocarbamato)- (6CI,7CI,8CI); Bis(N,N-diethyldithiocarbamato)selenium;Diethyldithiocarbamic acid selenium salt; Seleniumbis(N,N-diethyldithiocarbamate); Selenium diethyldithiocarbamate |
| CAS: | 136-92-5 |
| EINECS: | 205-267-9 |
| Molecular Formula: | C10H20 N2 S4 Se |
| Molecular Weight: | 375.52 |
| InChI: | InChI=1/C10H20N2S4Se/c1-5-11(6-2)9(13)15-17-16-10(14)12(7-3)8-4/h5-8H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 207.3°C |
| Boiling Point: | 419.1°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Diethyldithiocarbamic acid selenium(II) salt , its cas register number is 136-92-5. It also can be called N,N,6-triethyl-5-thioxo-2,4-dithia-3-selena-6-azaoctanethioamide ; (Selenobisthio)bis(N,N-diethylformthioamide) ; Bis(diethyldithiocarbamic acid) selenium salt ; Bis(N,N-diethyldithiocarbamic acid) selenium salt ; Bis(N,N-diethyldithiocarbamic acid)selenium(II) salt;Bis[(diethylthiocarbamoyl)thio] selenide . |
| Report: |
Selenium and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 207.3°C |
| Safety Data | |
 |
|
