| Identification | |
| Name: | (1R,2S)-1-Amino-2-indanol |
| Synonyms: | 1H-Inden-2-ol,1-amino-2,3-dihydro-, (1R-cis)-;((1R,2S)-2-Hydroxyindan-1-yl)amine;(+)-cis-1-Amino-2-indanol;(1R,2S)-(+)-1-Amino-2-indanol;(1R,2S)-1-Amino-2,3-dihydro-1H-inden-2-ol;1H-Inden-2-ol,1-amino-2,3-dihydro-, (1R,2S)-;(1R,2S)-cis-1-Amino-2-indanol;cis-(1R,2S)-1-Amino-2-indanol; |
| CAS: | 136030-00-7 |
| Molecular Formula: | C9H11NO |
| Molecular Weight: | 150.19768 |
| InChI: | InChI=1S/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/p+1/t8-,9+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 129.2 oC |
| Boiling Point: | 290 oC at 760 mmHg |
| Density: | 1.212 g/cm3 |
| Alpha: | 44.5 o (C=1, METHANOL) |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?(1R,2S)-1-Amino-2-indanol (CAS NO.136030-00-7) is also named as (1S,2R)-1-amino-2,3-dihydro-1H-inden-2-ol?; (1S,2R)-1-Aminoindan-2-ol ; 1H-inden-2-ol, 1-amino-2,3-dihydro-, (1S,2R)- ; Cis-(1S,2R)-1-amino-2-indanol ; (1R,2S)-1-amino-2-hydroxyindane ; (1S,2R)-(-)-Cis-1-Amino-2-indanol ; (1S,2R)-(?)-cis-1-Amino-2-hydroxyindane ; (1S,2R)-(?)-cis-1-Amino-2-indanol ; (1S,2R)-1-Amino-indan-2-ol .?(1R,2S)-1-Amino-2-indanol (CAS NO.136030-00-7) is white to light yellow crystal powder. |
| Flash Point: | 129.2 oC |
| Safety Data | |
 |
|
