| Identification |
| Name: | Benzenethiol,2,4-dimethyl- |
| Synonyms: | 2,4-Xylenethiol(6CI,7CI,8CI);2,4-Dimethylthiophenol;2,4-Thioxylenol;NSC 202925; |
| CAS: | 13616-82-5 |
| EINECS: | 237-100-0 |
| Molecular Formula: | C8H10S |
| Molecular Weight: | 138.23 |
| InChI: | InChI=1/C8H10S/c1-6-3-4-8(9)7(2)5-6/h3-5,9H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.022 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.568-1.57 |
| Solubility: | Insoluble |
| Appearance: | clear yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Stench |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
