| Identification | |
| Name: | 2-Amino-2'-deoxyinosine oxime |
| Synonyms: | LogP |
| CAS: | 136494-33-2 |
| Molecular Formula: | C10H14N6O4 |
| Molecular Weight: | 282.256 |
| InChI: | InChI=1/C10H14N6O4/c11-8-7-9(14-10(13-8)15-19)16(3-12-7)6-1-4(18)5(2-17)20-6/h3-7,17-19H,1-2H2,(H2,11,13,15)/t4-,5+,6+,7?/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 315.47°C |
| Boiling Point: | 598.018°C at 760 mmHg |
| Density: | 2.124g/cm3 |
| Refractive index: | 1.925 |
| Specification: |
2-Amino-2'-deoxyinosine oxime ,its cas register number is 136494-33-2. It also can be called Inosine, 2-amino-2'-deoxy-, oxime ; and 2-Amino-N(sup 6)-hydroxy-2'-deoxyadenosine . |
| Flash Point: | 315.47°C |
| Safety Data | |
 |
|
