Identification |
Name: | Chlorohexyl isocyanate |
Synonyms: | 6-Chlorohexyl isocyanate;Chlorohexyl isocyanate;omega-Chorohexyl isocyanate;6-Chlorhexylisokyanat [Czech];6-Chlorohexamethylene isocyanate;ISOCYANIC ACID, 6-CHLOROHEXYL ESTER;6-Chlorhexylisokyanat;AC1L1AK3;1-chloro-4-isocyanatocyclohexane;Hexane, 1-chloro-6-isocyanato-;Hexane, 1-chloro-6-isocyanato- (9CI);LS-84437 |
CAS: | 13654-91-6 |
Molecular Formula: | C7H10ClNO |
Molecular Weight: | 159.6134 |
InChI: | InChI=1/C7H10ClNO/c8-6-1-3-7(4-2-6)9-5-10/h6-7H,1-4H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 81.3°C |
Boiling Point: | 226.8°C at 760 mmHg |
Density: | 1.24g/cm3 |
Refractive index: | 1.55 |
Specification: |
Chlorohexyl isocyanate , its cas register number is 13654-91-6. It also can be called 6-Chlorhexylisokyanat ; 6-Chlorohexamethylene isocyanate ; 6-Chlorohexyl isocyanate ; and omega-Chorohexyl isocyanate .
|
Flash Point: | 81.3°C |
Safety Data |
|
 |