| Identification | |
| Name: | 2,7-Dibromo-9H-carbazole |
| Synonyms: | 2,7-Dibromocarbazole; |
| CAS: | 136630-39-2 |
| Molecular Formula: | C12H7Br2N |
| Molecular Weight: | 325.00 |
| InChI: | InChI=1/C12H7Br2N/c13-7-1-3-9-10-4-2-8(14)6-12(10)15-11(9)5-7/h1-6,15H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.93g/cm3 |
| Refractive index: | 1.796 |
| Specification: |
The 2,7-Dibromo-9H-carbazole, with cas registry number of 136630-39-2, is also called 2,7-Dibromocarbazole. And it is a kind of air sensitive chemical. Its molecular formula is C12H7Br2N. The characteristics of this chemical are as followings: (1)ACD/LogP: 5.26; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.26; (4)ACD/LogD (pH 7.4): 5.26; (5)ACD/BCF (pH 5.5): 5891.24; (6)ACD/BCF (pH 7.4): 5891.24; (7)ACD/KOC (pH 5.5): 17390.25; (8)ACD/KOC (pH 7.4): 17390.25; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 4.93 Å2; (13)Index of Refraction: 1.796; (14)Molar Refractivity: 71.75 cm3; (15)Molar Volume: 168.3 cm3; (16)Polarizability: 28.44×10-24cm3; (17)Surface Tension: 63.6 dyne/cm; (18)Density: 1.93 g/cm3; (19)Flash Point: 231.4 °C; (20)Enthalpy of Vaporization: 69.18 kJ/mol; (21)Boiling Point: 459 °C at 760 mmHg; (22)Vapour Pressure: 3.58E-08 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
