Identification |
Name: | 2-Cyclopentene-1-aceticacid |
CAS: | 13668-61-6 |
EINECS: | 237-146-1 |
Molecular Formula: | C7H10O2 |
Molecular Weight: | 126.15 |
InChI: | InChI=1/C7H10O2/c8-7(9)5-6-3-1-2-4-6/h1,3,6H,2,4-5H2,(H,8,9) |
Molecular Structure: |
|
Properties |
Stability: | Stable. Incompatible with bases, oxidizing agents, reducing agents. |
Refractive index: | n20/D 1.468(lit.) |
Water Solubility: | Stability Stable. Incompatible with bases, oxidizing agents, reducing agents. Toxicology Harmful if inhaled or swallowed. Skin, respiratory andeye irritant. Toxicity data |
Solubility: | |
Appearance: | colourless liquid with an unpleasant smell |
Safety Data |
|
|