| Identification |
| Name: | Ethanone,1-(2,6-difluorophenyl)- |
| Synonyms: | 2,6-Difluoroacetophenone;Acetophenone,2',6'-difluoro- (8CI);1-(2,6-Difluorophenyl)ethanone; |
| CAS: | 13670-99-0 |
| EINECS: | 237-151-9 |
| Molecular Formula: | C8H6F2O |
| Molecular Weight: | 156.13 |
| InChI: | InChI=1/C8H6F2O/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 170? |
| Density: | 1.197 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.48 |
| Appearance: | colorless to light yellow transparent liquid |
| Flash Point: | 170? |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
