| Identification |
| Name: | 1-Propanone,1-(2-thienyl)- |
| Synonyms: | 1-(Thiophen-2-yl)propan-1-one;2-Propanoylthiophene;2-Propionylthiophene;Ethyl 2-thienyl ketone;NSC 76041; |
| CAS: | 13679-75-9 |
| EINECS: | 237-182-8 |
| Molecular Formula: | C7H8OS |
| Molecular Weight: | 140.2 |
| InChI: | InChI=1/C7H8OS/c1-2-6(8)7-4-3-5-9-7/h3-5H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.126 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.552-1.554 |
| Appearance: | clear colourless to light brown liquid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
