| Identification | |
| Name: | 1-Hexanol, 3-mercapto-,1-acetate |
| Synonyms: | 3-Sulfanylhexylacetate;3-mercaptan hexyl acetate; |
| CAS: | 136954-20-6 |
| Molecular Formula: | C8H16O2S |
| Molecular Weight: | 176.28 |
| InChI: | InChI=1/C8H16O2S/c1-3-4-8(11)5-6-10-7(2)9/h8,11H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 109.8 ºC |
| Boiling Point: | 235.7 ºC at 760 mmHg |
| Density: | 0.987 g/cm3 |
| Refractive index: | 1.458 |
| Appearance: | colorless clear liquid |
| Specification: |
1-Hexanol, 3-mercapto-,1-acetate , its cas register number is 136954-20-6. It also can be called 3-Mercaptohexyl acetate ; and 3-Sulfanylhexyl acetate . |
| Flash Point: | 109.8 ºC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
