| Identification | |
| Name: | Cyclopentanone,2-heptyl- |
| Synonyms: | 2-(n-Heptyl)cyclopentanone;2-Heptylcyclopentan-1-one;Alismone;NSC 78468; |
| CAS: | 137-03-1 |
| EINECS: | 205-273-1 |
| Molecular Formula: | C12H22O |
| Molecular Weight: | 182.30 |
| InChI: | InChI=1/C12H22O/c1-2-3-4-5-6-8-11-9-7-10-12(11)13/h11H,2-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.887 g/cm3 |
| Refractive index: | 1.454 |
| Appearance: | Colorless to slight yellow liquid |
| Specification: |
Cyclopentanone, 2-heptyl- ,its cas register number is 137-03-1. Cyclopentanone, 2-heptyl- (CAS NO.137-03-1) also can be called 2-Heptylcyclopentanone ; alpha-Heptyl cyclopentanone ; 2-Heptylcyclopentan-1-one and 2-n-Heptylcyclopentanone . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
