| Identification | |
| Name: | 2-Chloroaniline hydrochloride |
| Synonyms: | 2-chloroanilinium chloride |
| CAS: | 137-04-2 |
| EINECS: | 205-274-7 |
| Molecular Formula: | C6H7Cl2N |
| Molecular Weight: | 164.03 |
| InChI: | InChI=1/C6H6ClN.ClH/c7-5-3-1-2-4-6(5)8;/h1-4H,8H2;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 97.8°C |
| Boiling Point: | 208.8°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Soluble in acid and in most organic solvents. Miscible in alcohol and ether Soluble in alcohol, ether, benzene, and acetone. In water, 8165 mg/L at 25 deg C |
| Packinggroup: | III |
| Flash Point: | 97.8°C |
| Color: | Amber liquid Water-white to tan liquid Colorless liquid |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
