| Identification | |
| Name: | 2-Aminothiophenol |
| Synonyms: | 2-Aminobenzenethiol; 2-Mercaptoaniline; 2-Aminothiophenol,98%; 2-Aminothiophenol/2-Aminobenzenethiol; o-aminothiophenol |
| CAS: | 137-07-5 |
| EINECS: | 205-277-3 |
| Molecular Formula: | C6H7NS |
| Molecular Weight: | 125.19 |
| InChI: | InChI=1/C6H7NS/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1760 |
| Density: | 1.16 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.64-1.644 |
| Water Solubility: | INSOLUBLE |
| Solubility: | insoluble in water |
| Appearance: | clear yellow to amber liquid |
| Specification: |
? 2-Aminobenzenethiol (CAS NO.137-07-5), its Synonyms are 1-Amino-2-mercaptobenzene ; 2-Aminothiophenol ; 2-Mercaptaniline ; 2-Mercaptoaniline ; o-Aminobenzenethiol ; o-Aminothiophenol ; o-Mercaptoaniline ; Benzenethiol, 2-amino- ; Benzenethiol, o-amino- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Do not expose to air. Store under an inert atmosphere. |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
