| Identification | |
| Name: | 2,4-diaminophenol dihydrochloride |
| Synonyms: | 2,4-diaminophenol hydrochloride |
| CAS: | 137-09-7 |
| EINECS: | 205-279-4 |
| Molecular Formula: | C6H8N2O?2(HCl) |
| Molecular Weight: | 197.06 |
| InChI: | InChI=1/C6H8N2O.2ClH/c7-4-1-2-6(9)5(8)3-4;;/h1-3,9H,7-8H2;2*1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.343 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, acids. Heat and light sensitive. |
| Solubility: | 27.5 g/100 mL (15 ºC) in water |
| Appearance: | green crystalline powder. |
| Specification: |
Air & Water Reactions: Water soluble. |
| Packinggroup: | III |
| HS Code: | 29222900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | GRAYISH-WHITE CRYSTALS NEEDLES |
| Usage: | As photographic developer, in fur & hair dyeing, in test for formaldehyde & ammonia. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
