| Identification |
| Name: | Glycine,N-methyl-N-(1-oxododecyl)-, sodium salt (1:1) |
| Synonyms: | Glycine,N-methyl-N-(1-oxododecyl)-, sodium salt (9CI);Sarcosine, N-lauroyl-, sodiumsalt (8CI);N-Dodecanoyl-N-methylglycine sodium salt;N-Dodecanoylsarcosine sodium salt;N-Lauroyl-N-methylglycine sodium salt;N-Lauroylsarcosine sodium;Nikkol SarcosinateLN;Nikkol Sarcosinate LN 3;Nikkol Sarcosine Na;Oramix L 30;Perlastan L 30;ProtelanLS 9011; |
| CAS: | 137-16-6 |
| EINECS: | 205-281-5 |
| Molecular Formula: | C15H28NNaO3 |
| Molecular Weight: | 293.38 |
| InChI: | InChI=1/C15H29NO3.Na/c1-3-4-5-6-7-8-9-10-11-12-14(17)16(2)13-15(18)19;/h3-13H2,1-2H3,(H,18,19);/q;+1/p-1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 200kgs |
| Flash Point: | 94 C (30%) |
| Boiling Point: | 100 C (30%) |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | Clear liquid |
| HS Code: | 34021190 |
| Flash Point: | 94 C (30%) |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Dog and cat repellent. |
| Safety Data |
| Hazard Symbols |
|
| |
 |
