| Identification | |
| Name: | Tetramethylthiuram disulfide |
| Synonyms: | bis(dimethylthiocarbamyl) disulphide; thiram; thiram (tmtd); tmtd; tetramethylthiuram disulphide; tetramethyl thiuram disulfide; 1,1'-dithiobis(n,n-dimethylthio-formamid; 1,1'-dithiobis(n,n-dimethylthioformamide); aapirol; accel tmt; accelerator t; accelerator thiuram; acceleratort; acceleratorthiuram; acceleratortmtd; aceto tetd; acetotetd; alpha,alpha'-dithiobis(dimethylthio)formamide; anles; arasan; arasan 42s; arasan 70; arasan 70-s red; arasan 75; arasan42-s |
| CAS: | 137-26-8 |
| EINECS: | 205-286-2 |
| Molecular Formula: | C6H12N2S4 |
| Molecular Weight: | 240.41 |
| InChI: | InChI=1/C6H12N2S4/c1-7(2)5(9)11-12-6(10)8(3)4/h1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2771/2811 |
| Density: | 1.43 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.677 |
| Appearance: | white to off white powder |
| Specification: |
? Tetramethylthiuram disulfide?with cas registry number of 137-26-8?is white to almost white powder, also called?Disulfide, bis(dimethylthiocarbamoyl) ; Thioperoxydicarbonic diamide (((H2N)C(S))2S2), N,N,N',N'-tetramethyl- ; Thioperoxydicarbonic diamide (((H2N)C(S))2S2), tetramethyl- ; Thiram?; RCRA waste no. U244 .?It is incompatible with oxidizing materials, strong acids, strong alkalis and nitrating agents.?Tetramethylthiuram disulfide is always used for rice, wheat, TOBACCO, sugar beet, grapes and other crop diseases and pests, and it also can be used for seed dressing and soil treatment. |
| Packinggroup: | III |
| HS Code: | 29303000 |
| Color: | White crystalline powder Colorless to yellow, crystalline solid. (Note: commercial pesticide product may be dyed blue.) |
| Usage: | Fungicide for large brown patch snowmold and dollar spot on fine turfs. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
