Identification |
Name: | Quinoline,5,7-dimethoxy-3-(4-pyridinyl)- |
Synonyms: | 5,7-Dimethoxy-3-(4-pyridinyl)quinoline |
CAS: | 137206-97-4 |
Molecular Formula: | C16H14 N2 O2 |
Molecular Weight: | 339.22 |
InChI: | InChI=1/C16H14N2O2/c1-19-13-8-15-14(16(9-13)20-2)7-12(10-18-15)11-3-5-17-6-4-11/h3-10H,1-2H3 |
Molecular Structure: |
![(C16H14N2O2) 5,7-Dimethoxy-3-(4-pyridinyl)quinoline](https://img1.guidechem.com/chem/e/dict/208/137206-97-4.jpg) |
Properties |
Flash Point: | 158.7°C |
Boiling Point: | 441.3°C at 760 mmHg |
Density: | 1.192g/cm3 |
Refractive index: | 1.617 |
Biological Activity: | A potent and selective inhibitor of human vascular β -type platelet derived growth factor receptor tyrosine kinase (PDGFR β ) (IC 50 = 80 nM). Displays > 100-fold selectivity over EGFR tyrosine kinase, erbB2, p56, protein kinase A and protein kinase C. |
Flash Point: | 158.7°C |
Safety Data |
|
![](/images/detail_15.png) |