Identification |
Name: | Serine, N-carboxy-,dibenzyl ester, bis(2-chloropropyl)carbamate (ester), DL- (8CI) |
Synonyms: | Carbamicacid, bis(2-chloropropyl)-, ester with N-carboxy-DL-serine dibenzyl ester; NSC156283 |
CAS: | 13723-34-7 |
Molecular Formula: | C25H30 Cl2 N2 O6 |
Molecular Weight: | 525.4215 |
InChI: | InChI=1/C25H30Cl2N2O6/c1-18(26)13-29(14-19(2)27)25(32)35-17-22(23(30)33-15-20-9-5-3-6-10-20)28-24(31)34-16-21-11-7-4-8-12-21/h3-12,18-19,22H,13-17H2,1-2H3,(H,28,31) |
Molecular Structure: |
 |
Properties |
Flash Point: | 351.9°C |
Boiling Point: | 658.2°C at 760 mmHg |
Density: | 1.266g/cm3 |
Refractive index: | 1.556 |
Flash Point: | 351.9°C |
Safety Data |
|
 |