| Identification | |
| Name: | 1,4-Benzenedicarboxylicacid, 2,5-dibromo- |
| Synonyms: | Terephthalicacid, 2,5-dibromo- (6CI,7CI,8CI); 1,4-Dibromo-2,5-benzenedicarboxylic acid;2,5-Dibromo-4-carboxybenzoic acid; 2,5-Dibromoterephthalic acid; NSC 115430 |
| CAS: | 13731-82-3 |
| EINECS: | 237-300-8 |
| Molecular Formula: | C8H4 Br2 O4 |
| Molecular Weight: | 323.92 |
| InChI: | InChI=1/C8H4Br2O4/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h1-2H,(H,11,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 222.9°C |
| Boiling Point: | 445°C at 760 mmHg |
| Density: | 2.205g/cm3 |
| Refractive index: | 1.679 |
| Specification: |
1,4-Benzenedicarboxylicacid, 2,5-dibromo- , its cas register number is 13731-82-3. It also can be called 2,5-Dibromoterephthalic acid ; NSC 115430 . 1,4-Benzenedicarboxylicacid, 2,5-dibromo- (CAS NO.13731-82-3) is irritating to eyes, respiratory system and skin. |
| Flash Point: | 222.9°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
