| Identification | |
| Name: | Benzene,1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)- |
| Synonyms: | Ether,2,4-dichloro-6-fluorophenyl p-nitrophenyl (8CI);2,4-Dichloro-6-fluoro-4'-nitrodiphenyl ether; 2,4-Dichloro-6-fluorophenyl4-nitrophenyl ether; 2,4-Dichloro-6-fluorophenyl-p-nitrophenyl ether;2-Fluoro-4,6-dichloro-4'-nitrodiphenyl ether; 2-Fluoro-4,6-dichlorophenyl4-nitrophenyl ether; 4-Nitro-2',4'-dichloro-6'-fluorodiphenyl ether; CFNP;Fluoronitrofen |
| CAS: | 13738-63-1 |
| Molecular Formula: | C12H6 Cl2 F N O3 |
| Molecular Weight: | 302.09 |
| InChI: | InChI=1/C12H6Cl2FNO3/c13-7-5-10(14)12(11(15)6-7)19-9-3-1-8(2-4-9)16(17)18/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.6°C |
| Boiling Point: | 333.7°Cat760mmHg |
| Density: | 1.51g/cm3 |
| Refractive index: | 1.606 |
| Specification: |
Fluoronitrofen with cas registry number of 13738-63-1 is also known as 2,4-Dichloro-6-fluorophenyl p-nitrophenyl ether ; 2,4-Dichloro-6-fluorophenyl-4'-nitrophenyl ether ; Benzene,1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)- ; Benzene,1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)- (9CI) ; Ether, 2,4-dichloro-6-fluorophenyl p-nitrophenyl . It would emit very toxic vapors when heated to decomposition. Fluoronitrofen with cas registry number of 13738-63-1 is used as a herbicide . |
| Flash Point: | 155.6°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
