| Identification | |
| Name: | Benzenamine,4-[(phenylthio)methyl]- |
| Synonyms: | p-Toluidine,a-(phenylthio)- (6CI,7CI,8CI);4-[(Phenylsulfanyl)methyl]aniline; NSC 89479 |
| CAS: | 13738-70-0 |
| Molecular Formula: | C13H13 N S |
| Molecular Weight: | 215.33 |
| InChI: | InChI=1/C13H13NS/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13/h1-9H,10,14H2 |
| Molecular Structure: | ![(C13H13NS) p-Toluidine,a-(phenylthio)- (6CI,7CI,8CI);4-[(Phenylsulfanyl)methyl]aniline; NSC 89479](https://img1.guidechem.com/chem/e/dict/52/13738-70-0.jpg) |
| Properties | |
| Melting Point: | 73-75°C |
| Flash Point: | 183°C |
| Boiling Point: | 378.9°Cat760mmHg |
| Density: | 1.16g/cm3 |
| Refractive index: | 1.656 |
| Specification: |
alpha-(Phenylthio)-p-toluidine , its cas register number is 13738-70-0. It also can be called Benzenamine, 4-((phenylthio)methyl)- (9CI) ; and p-Toluidine, alpha-(phenylthio)- . |
| Flash Point: | 183°C |
| Safety Data | |
 |
|
