| Identification | |
| Name: | L-Cysteine,(3-phenylpropyl)carbamodithioate (ester) (9CI) |
| Synonyms: | S-[N-(3-PHENYLPROPYL)(THIOCARBAMOYL)]-L-CYSTEINE;S-(N-PHENYLPROPYLTHIOCARBAMOYL)-L-*CYSTE INE;S-(N-(3-phenylpropyl)(thiocarbamoyl))-cysteine |
| CAS: | 137915-13-0 |
| Molecular Formula: | C13H18 N2 O2 S2 |
| Molecular Weight: | 298.4242 |
| InChI: | InChI=1/C13H18N2O2S2/c14-11(12(16)17)9-19-13(18)15-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9,14H2,(H,15,18)(H,16,17)/t11-/m0/s1 |
| Molecular Structure: | ![(C13H18N2O2S2) S-[N-(3-PHENYLPROPYL)(THIOCARBAMOYL)]-L-CYSTEINE;S-(N-PHENYLPROPYLTHIOCARBAMOYL)-L-*CYSTE INE;S-(N-(...](https://img1.guidechem.com/chem/e/dict/148/137915-13-0.jpg) |
| Properties | |
| Melting Point: | 224ºC-225ºC (dec.; lit.) |
| Density: | 1.29 g/cm3 |
| Refractive index: | 1.636 |
| Usage: | Induction of Glutathione S-transerase (GST) activity by anticarcinogenic compounds is believed to be a major mechanism for carcinogen detoxification. This compound has shown to induce Glutathione S-transerase activity in target organs of mice with |
| Safety Data | |
 |
|
