| Identification | |
| Name: | Phenol, 2,4-dipentyl- |
| Synonyms: | 2,4-Di-n-amylphenol;2,4-Di-n-pentylphenol;2,4-Dipentylphenol; |
| CAS: | 138-00-1 |
| Molecular Formula: | C16H26O |
| Molecular Weight: | 234.38 |
| InChI: | InChI=1/C16H26O/c1-3-5-7-9-14-11-12-16(17)15(13-14)10-8-6-4-2/h11-13,17H,3-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 159.7°C |
| Boiling Point: | 340.2°Cat760mmHg |
| Density: | 0.928g/cm3 |
| Refractive index: | 1.506 |
| Specification: |
The 2,4-Dipentylphenol with the cas number 138-00-1, is also called 2,4-Diamylphenol. The systematic name is Phenol, 2,4-dipentyl-. Its system generated number is 0000138001. The molecular formula is C16H26O. This chemical is a kind of organics. It should be stored in dry and cool environment. You can still convert the following datas into molecular structure: |
| Flash Point: | 159.7°C |
| Safety Data | |
 |
|
