| Identification |
| Name: | n-Butyl Lactate |
| Synonyms: | 2-Propanoic Acid; Butyl 2-hydroxypropanoate; Butyl alpha-Hydroxypropionate; Butyl Lactate; Lactic Acid Butyl Ester; |
| CAS: | 138-22-7 |
| EINECS: | 205-316-4 |
| Molecular Formula: | C7H14O3 |
| Molecular Weight: | 146.18 |
| InChI: | InChI=1/C7H14O3/c1-3-4-5-10-7(9)6(2)8/h6,8H,3-5H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.98 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.42-1.422 |
| Water Solubility: | 42 g/L (25 oC) |
| Solubility: | 42 g/L (25 ºC) |
| Appearance: | A clear colorless liquid with a mild odor. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Food and feed additive. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
