| Identification |
| Name: | Cyclohexene,1-methyl-4-(1-methylethenyl)- |
| Synonyms: | (+-)-Dipentene;(+-)-Linonene;Limonene;(+-)-alpha-Limonene;1,8-p-Menthadiene;1-Methyl-4-(1-methylethenyl)cyclohexene;1-Methyl-4-isopropenyl-1-cyclohexene;1-Methyl-p-isopropenyl-1-cyclohexene;4-Isopropenyl-1-methyl-1-cyclohexene;AI3-00739; |
| CAS: | 138-86-3 |
| EINECS: | 205-341-0 |
| Molecular Formula: | C10H16 |
| Molecular Weight: | 136.24 |
| InChI: | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2052 |
| Melting Point: | -97 oC |
| Flash Point: | 46 oC |
| Boiling Point: | 170 - 180 C |
| Density: | 0.84 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.472-1.485 |
| Water Solubility: | | |
| Solubility: | Practically insoluble |
| Appearance: | clear to pale yellow liquid with a lemon-like odor |
| Packinggroup: | III |
| Flash Point: | 46 oC |
| Color: | Liquid |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
| |
 |
