Identification |
Name: | Cyclohexene,1-methyl-4-(1-methylethenyl)- |
Synonyms: | (+-)-Dipentene;(+-)-Linonene;Limonene;(+-)-alpha-Limonene;1,8-p-Menthadiene;1-Methyl-4-(1-methylethenyl)cyclohexene;1-Methyl-4-isopropenyl-1-cyclohexene;1-Methyl-p-isopropenyl-1-cyclohexene;4-Isopropenyl-1-methyl-1-cyclohexene;AI3-00739; |
CAS: | 138-86-3 |
EINECS: | 205-341-0 |
Molecular Formula: | C10H16 |
Molecular Weight: | 136.24 |
InChI: | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2052 |
Melting Point: | -97 oC |
Flash Point: | 46 oC |
Boiling Point: | 170 - 180 C |
Density: | 0.84 |
Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.472-1.485 |
Water Solubility: | | |
Solubility: | Practically insoluble |
Appearance: | clear to pale yellow liquid with a lemon-like odor |
Packinggroup: | III |
Flash Point: | 46 oC |
Color: | Liquid |
Safety Data |
Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
|
 |