| Identification | |
| Name: | 3-Thiophenecarbonitrile,2-amino-5-methyl- |
| Synonyms: | 2-Amino-5-methyl-3-thiophenecarbonitrile; |
| CAS: | 138564-58-6 |
| Molecular Formula: | C6H6N2S |
| Molecular Weight: | 138.19 |
| InChI: | InChI=1/C5H6N2O2S/c1-3-2-4(7(8)9)5(6)10-3/h2H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Melting Point: | 101-103°C |
| Flash Point: | 146.4°C |
| Boiling Point: | 318.5°Cat760mmHg |
| Density: | 1.26g/cm3 |
| Refractive index: | 1.658 |
| Specification: |
The extinguishing agent of 2-Amino-5-methylthiopene-3-carbonitrile (CAS No.138564-58-6) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 146.4°C |
| Safety Data | |
 |
|
