| Identification |
| Name: | Cyclohexanecarboxylicacid, 1-phenyl-, 2-(4-morpholinyl)ethyl ester |
| Synonyms: | PRE 084 |
| CAS: | 138847-85-5 |
| Molecular Formula: | C19H27 N O3 |
| Molecular Weight: | 353.88 |
| InChI: | InChI=1/C19H27NO3/c21-18(23-16-13-20-11-14-22-15-12-20)19(9-5-2-6-10-19)17-7-3-1-4-8-17/h1,3-4,7-8H,2,5-6,9-16H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 223.9°C |
| Boiling Point: | 446.6°Cat760mmHg |
| Density: | 1.103g/cm3 |
| Refractive index: | 1.532 |
| Biological Activity: | High affinity, selective σ 1 agonist (K i values are 2.2 and 13091 nM for σ 1 and σ 2 receptors respectively). Selective over PCP receptors (IC 50 > 100000 nM) and several other receptor systems. Produces antiamnesic and antitussive effects in vivo . |
| Flash Point: | 223.9°C |
| Safety Data |
| |
 |
