| Identification | |
| Name: | Phytorob 926-67 |
| Synonyms: | Phytorob 926-67 |
| CAS: | 139152-82-2 |
| Molecular Formula: | C19H36O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h10-11H,3-9,12-18H2,1-2H3/b11-10- |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -19.9 deg C |
| Boiling Point: | 218.5 deg C @ 20 mm Hg |
| Solubility: | Insol in water; miscible with ethyl alcohol, ether; sol in chloroform |
| Color: | Colorless to amber clear liquid |
| Safety Data | |
 |
|
