| Identification |
| Name: | Pyrazine,2-ethyl-6-methyl- |
| Synonyms: | 2-Ethyl-6-methylpyrazine;2-Methyl-6-ethylpyrazine;6-Methyl-2-ethylpyrazine; |
| CAS: | 13925-03-6 |
| EINECS: | 237-692-0 |
| Molecular Formula: | C7H10N2 |
| Molecular Weight: | 122.1677 |
| InChI: | InChI=1/C7H10N2/c1-3-7-5-8-4-6(2)9-7/h4-5H,3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.977 g/cm3 |
| Refractive index: | 1.5 |
| Water Solubility: | soluble in water, organic solvents |
| Solubility: | soluble in water, organic solvents |
| Appearance: | colourless to slightly yellow liquid with a roasted baked potato odour |
| Safety Data |
| |
 |
