| Identification |
| Name: | Pyrazine,2-methyl-5-(1-methylethyl)- |
| Synonyms: | Pyrazine,2-isopropyl-5-methyl- (8CI);2-Isopropyl-5-methylpyrazine;2-Methyl-5-(1-methylethyl)pyrazine;2-Methyl-5-isopropylpyrazine;5-Isopropyl-2-methylpyrazine; |
| CAS: | 13925-05-8 |
| Molecular Formula: | C8H12N2 |
| Molecular Weight: | 136.19 |
| InChI: | InChI=1/C8H12N2/c1-6(2)8-5-9-7(3)4-10-8/h4-6H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.957 g/cm3 |
| Refractive index: | 1.494 |
| Water Solubility: | soluble in water, soluble in oils, organic solvents |
| Solubility: | soluble in water, soluble in oils, organic solvents |
| Appearance: | colourless to slightly yellow liquid with a roasted, coffee, nutty, earthy odour |
| Safety Data |
| |
 |
