| Identification |
| Name: | Pyrazine, 2-methyl-3-(2-methylpropyl)- |
| Synonyms: | Pyrazine,2-isobutyl-3-methyl- (8CI);2-Isobutyl-3-methylpyrazine;2-Methyl-3-isobutylpyrazine; |
| CAS: | 13925-06-9 |
| EINECS: | 237-693-6 |
| Molecular Formula: | C9H14N2 |
| Molecular Weight: | 150.2209 |
| InChI: | InChI=1/C9H14N2/c1-7(2)6-9-8(3)10-4-5-11-9/h4-5,7H,6H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Refractive index: | n20/D 1.492(lit.) |
| Water Solubility: | soluble in water, oils, organic solvents |
| Solubility: | soluble in water, oils, organic solvents |
| Appearance: | colourless to slightly yellow liquid with a green, earthy, celery odour |
| Safety Data |
| |
 |
