Identification |
Name: | Pyrazine, 2-methyl-3-(2-methylpropyl)- |
Synonyms: | Pyrazine,2-isobutyl-3-methyl- (8CI);2-Isobutyl-3-methylpyrazine;2-Methyl-3-isobutylpyrazine; |
CAS: | 13925-06-9 |
EINECS: | 237-693-6 |
Molecular Formula: | C9H14N2 |
Molecular Weight: | 150.2209 |
InChI: | InChI=1/C9H14N2/c1-7(2)6-9-8(3)10-4-5-11-9/h4-5,7H,6H2,1-3H3 |
Molecular Structure: |
|
Properties |
Refractive index: | n20/D 1.492(lit.) |
Water Solubility: | soluble in water, oils, organic solvents |
Solubility: | soluble in water, oils, organic solvents |
Appearance: | colourless to slightly yellow liquid with a green, earthy, celery odour |
Safety Data |
|
|