Specification: |
The 2-(7-Methoxy-1-naphthyl)ethylamine hydrochloride is an organic compound with the formula C13H15NO.HCl. The systematic name of this chemical is 2-(7-methoxynaphthalen-1-yl)ethanamine hydrochloride (1:1). With the CAS registry number 139525-77-2, it is also named as 1-naphthaleneethanamine, 7-methoxy-, hydrochloride (1:1).
The other characteristics of this product can be summarized as: (1)ACD/LogP: 2.60; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.34; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 3.36; (8)#H bond acceptors: 2; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 4; (11)Flash Point: 185.5 °C; (12)Enthalpy of Vaporization: 64.39 kJ/mol; (13)Boiling Point: 383.1 °C at 760 mmHg; (14)Vapour Pressure: 3.04E-06 mmHg at 25°C.
People can use the following data to convert to the molecule structure.
1. SMILES:Cl.O(c2ccc1c(c(ccc1)CCN)c2)C
2. InChI:InChI=1/C13H15NO.ClH/c1-15-12-6-5-10-3-2-4-11(7-8-14)13(10)9-12;/h2-6,9H,7-8,14H2,1H3;1H
3. InChIKey:HPYGZUDDGWEYDQ-UHFFFAOYAJ
4. Std. InChI:InChI=1S/C13H15NO.ClH/c1-15-12-6-5-10-3-2-4-11(7-8-14)13(10)9-12;/h2-6,9H,7-8,14H2,1H3;1H
5. Std. InChIKey:HPYGZUDDGWEYDQ-UHFFFAOYSA-N
|