Identification |
Name: | Diborane(4),1,1,2,2-tetrafluoro- |
Synonyms: | Boronfluoride (B2F4) (6CI); Diborane(4), tetrafluoro- (8CI,9CI); Diborontetrafluoride; Tetrafluorodiborane |
CAS: | 13965-73-6 |
Molecular Formula: | B2F4 |
Molecular Weight: | 97.61 |
InChI: | InChI=1/B2F4/c3-1(4)2(5)6 |
Molecular Structure: |
 |
Properties |
Density: | 1.036g/cm3 |
Refractive index: | 1.157 |
Specification: |
Diboron tetrafluoride ,its cas register number is 13965-73-6. It also can be called Boron fluoride (B2F4) ; and Difluoroborane .
|
Safety Data |
|
 |