| Identification | |
| Name: | 2,5,8-Benzotrioxacycloundecin-1,9-dione, 3,4,6,7-tetrahydro- |
| Synonyms: | Phthalicacid, cyclic oxydiethylene ester (8CI);Diethylene glycol, cyclic phthalate(8CI);Diethylene glycol bisphthalate; |
| CAS: | 13988-26-6 |
| EINECS: | 237-784-0 |
| Molecular Formula: | C12H12O5 |
| Molecular Weight: | 236.24 |
| InChI: | InChI=1/C12H12O5/c13-11-9-3-1-2-4-10(9)12(14)17-8-6-15-5-7-16-11/h1-4H,5-8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.236 g/cm3 |
| Refractive index: | 1.512 |
| Specification: |
2,5,8-Benzotrioxacycloundecin-1,9-dione, 3,4,6,7-tetrahydro- , with CAS number of 13988-26-6, can be called 2,5,8-benzotrioxacycloundecin-1,9-dione, 3,4,6,7-tetrahydro- ; 3,4,6,7-Tetrahydro-2,5,8-benzotrioxacycloundecine-1,9-dione . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
