| Identification |
| Name: | 3-Pyridinecarboxaldehyde,1,2,5,6-tetrahydro-1-methyl-, O-methyloxime, [C(E)]- |
| Synonyms: | 3-Pyridinecarboxaldehyde,1,2,5,6-tetrahydro-1-methyl-, O-methyloxime, (E)-; Milameline |
| CAS: | 139886-32-1 |
| Molecular Formula: | C8H14 N2 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H14N2O/c1-10-5-3-4-8(7-10)6-9-11-2/h4,6H,3,5,7H2,1-2H3/b9-6+ |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 87.5°C |
| Boiling Point: | 221.1°Cat760mmHg |
| Density: | 1g/cm3 |
| Refractive index: | 1.499 |
| Biological Activity: | Muscarinic receptor agonist that displays roughly equal affinity at all receptor subtypes (K i values are 2.3, 2.4, 3.6, 3.8 and 4.3 μ M for hM 1 , hM 2 , hM 3 , hM 4 and hM 5 receptors respectively). Cognitive enhancer; reverses spatial memory deficits in rats. |
| Flash Point: | 87.5°C |
| Safety Data |
| |
 |
