| Identification | |
| Name: | 4-Fluoro-3-methylphenylboronic acid |
| Synonyms: | Boronicacid, (4-fluoro-3-methylphenyl)- (9CI);(4-Fluoro-3-methylphenyl)boronic acid;3-Methyl-4-fluorophenylboronic acid; |
| CAS: | 139911-27-6 |
| EINECS: | -0 |
| Molecular Formula: | C7H8BFO2 |
| Molecular Weight: | 153.95 |
| InChI: | InChI=1/C7H8BFO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,10-11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.523g/cm3 |
| Refractive index: | 1.505 |
| Appearance: | Off-white Cryst |
| Specification: |
4-Fluoro-3-methylphenylboronic acid , with CAS number of 139911-27-6, can be called Boronicacid, (4-fluoro-3-methylphenyl)- (9CI) ; 3-Methyl-4-fluorophenylboronic acid ; 4-Fluoro-3-methylbenzeneboronic acid . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
