| Identification | |
| Name: | Ethanol, 2-chloro-,1,1',1''-phosphite |
| Synonyms: | Ethanol,2-chloro-, phosphite (3:1) (8CI,9CI); Ethanol, 2-chloro-, phosphite (6CI,7CI);CLP 1; NSC 6514; Phosphorous acid, tris(2-chloroethyl) ester;Tri(2-chloroethyl) phosphite; Tris(2-chloroethyl) phosphite; Tris(chloroethyl)phosphite; Tris(b-chloroethyl)phosphite |
| CAS: | 140-08-9 |
| EINECS: | 205-397-6 |
| Molecular Formula: | C6H12 Cl3 O3 P |
| Molecular Weight: | 269.50 |
| InChI: | InChI=1/C6H12Cl3O3P/c7-1-4-10-13(11-5-2-8)12-6-3-9/h1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6.1/PG 3 |
| Flash Point: | 97.2°C |
| Boiling Point: | 290.5°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | n20/D 1.487(lit.) |
| Solubility: | Miscible with most common organic solvents Slightly soluble in water; decomposes when dissolved. In water, 950 mg/L at 25 deg C (est) |
| Specification: |
Tris(2-chloroethyl) phosphite ,its CAS NO. is 140-08-9,the synonyms is 2-Chloroethanol phosphite (3:1) ; 4-01-00-01378 (Beilstein Handbook Reference) ; BRN 1704979 ; CCRIS 5949 ; EINECS 205-397-6 ; Ethanol, 2-chloro-, phosphite (3:1) ; HSDB 2584 ; NSC 6514 ; Phosphorous acid, tris(2-chloroethyl) ester ; Tris(2-chloroethyl)ester of phosphorus acid ; Tris(2-chloroethyl)phosphite ; Tris(beta-chloroethyl) phosphite ; Ethanol, 2-chloro-, 1,1',1''-phosphite ; Ethanol, 2-chloro-, phosphite (3:1) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 97.2°C |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
