| Identification | |
| Name: | Benzyl acetate |
| Synonyms: | Acetic acid benzyl ester; Benzyl ethanoate; |
| CAS: | 140-11-4 |
| EINECS: | 205-399-7 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.17 |
| InChI: | InChI=1/C9H10O2/c1-8(10)11-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.055 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.501-1.503 |
| Water Solubility: | practically insoluble |
| Solubility: | practically insoluble |
| Appearance: | Colorless liquid with an odor of pears. |
| Specification: |
? Benzyl acetate (CAS NO.140-11-4), its Synonyms are Acetic acid, benzyl ester ; Acetic acid, phenylmethyl ester ; Benzyl ethanoate ; Benzylester kyseliny octove ; Phenylmethyl acetate ; Phenylmethyl ethanoate ; alpha-Acetoxytoluene . |
| Packinggroup: | Z01 |
| HS Code: | 29153950 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | WATER-WHITE LIQUID |
| Usage: | In perfumery, solvent for cellulose acetate and nitrate. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
