Identification |
Name: | 2-Methyl-5-vinylpyridine |
Synonyms: | 2-Picoline,5-vinyl- (8CI);2-MVP;5-Ethenyl-2-methylpyridine;BRN 0106229;HSDB 6325;MVP; |
CAS: | 140-76-1 |
EINECS: | 205-432-5 |
Molecular Formula: | C8H9N |
Molecular Weight: | 119.16 |
InChI: | InChI=1/C8H9N/c1-3-8-5-4-7(2)9-6-8/h3-6H,1H2,2H3 |
Molecular Structure: |
|
Properties |
Transport: | 2810 |
Flash Point: | 56.6°C |
Boiling Point: | 175.5°C at 760mmHg |
Density: | 0.954g/cm3 |
Refractive index: | 1.555 |
Appearance: | Clear to faintly opalescent liquid |
Packinggroup: | III |
Flash Point: | 56.6°C |
Color: | Clear to faintly opalescent liquid |
Safety Data |
|
|